C8H9Cl2NO — CID 163964753
(E)-2-[(E)-1,3-dichloroprop-1-enyl]iminopent-3-enal (PubChem CID 163964753) has the molecular formula C8H9Cl2NO and a molecular weight of 206.07 g/mol. Its IUPAC name is (E)-2-[(E)-1,3-dichloroprop-1-enyl]iminopent-3-enal.
| Compound Name | (E)-2-[(E)-1,3-dichloroprop-1-enyl]iminopent-3-enal |
|---|---|
| PubChem CID | 163964753 |
| Molecular Formula | C8H9Cl2NO |
| Molecular Weight | 206.07 g/mol |
| Exact Mass | 205.01 |
| IUPAC Name | (E)-2-[(E)-1,3-dichloroprop-1-enyl]iminopent-3-enal |
| SMILES | C/C=C/C(C=O)=N/C(Cl)=C\CCl |
| InChI | InChI=1S/C8H9Cl2NO/c1-2-3-7(6-12)11-8(10)4-5-9/h2-4,6H,5H2,1H3/b3-2+,8-4-,11-7? |
| InChIKey | SKRSQGAJWOWKHN-ISAQIDDISA-N |
| XLogP | 2.52 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.07 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|