C10H14N2O2 — CID 163965647
4-(4-aminocyclohexa-2,4-dien-1-yl)morpholin-3-one (PubChem CID 163965647) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 4-(4-aminocyclohexa-2,4-dien-1-yl)morpholin-3-one.
| Compound Name | 4-(4-aminocyclohexa-2,4-dien-1-yl)morpholin-3-one |
|---|---|
| PubChem CID | 163965647 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 4-(4-aminocyclohexa-2,4-dien-1-yl)morpholin-3-one |
| SMILES | NC1=CCC(N2CCOCC2=O)C=C1 |
| InChI | InChI=1S/C10H14N2O2/c11-8-1-3-9(4-2-8)12-5-6-14-7-10(12)13/h1-3,9H,4-7,11H2 |
| InChIKey | SLMHZKFLVPSFFO-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |