C6H7NO2 — CID 163966892
6-(hydroxymethylidene)-1,2-dihydropyridin-5-one (PubChem CID 163966892) has the molecular formula C6H7NO2 and a molecular weight of 125.13 g/mol. Its IUPAC name is 6-(hydroxymethylidene)-1,2-dihydropyridin-5-one.
| Compound Name | 6-(hydroxymethylidene)-1,2-dihydropyridin-5-one |
|---|---|
| PubChem CID | 163966892 |
| Molecular Formula | C6H7NO2 |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.05 |
| IUPAC Name | 6-(hydroxymethylidene)-1,2-dihydropyridin-5-one |
| SMILES | O=C1C=CCNC1=CO |
| InChI | InChI=1S/C6H7NO2/c8-4-5-6(9)2-1-3-7-5/h1-2,4,7-8H,3H2 |
| InChIKey | BGLXLQXATCCARF-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|