C5H6N2O3 — CID 20678253
(3E)-3-(hydroxymethylidene)piperazine-2,5-dione (PubChem CID 20678253) has the molecular formula C5H6N2O3 and a molecular weight of 142.11 g/mol. Its IUPAC name is (3E)-3-(hydroxymethylidene)piperazine-2,5-dione.
| Compound Name | (3E)-3-(hydroxymethylidene)piperazine-2,5-dione |
|---|---|
| PubChem CID | 20678253 |
| Molecular Formula | C5H6N2O3 |
| Molecular Weight | 142.11 g/mol |
| Exact Mass | 142.04 |
| IUPAC Name | (3E)-3-(hydroxymethylidene)piperazine-2,5-dione |
| SMILES | O=C1CNC(=O)/C(=C\O)N1 |
| InChI | InChI=1S/C5H6N2O3/c8-2-3-5(10)6-1-4(9)7-3/h2,8H,1H2,(H,6,10)(H,7,9)/b3-2+ |
| InChIKey | PKEHXOGKKVLBKG-NSCUHMNNSA-N |
| XLogP | -1.37 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.11 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|