C14H19N3O2 — CID 163420627
(3Z)-3-[(5-tert-butyl-3,4-dihydropyridin-6-yl)methylidene]piperazine-2,5-dione (PubChem CID 163420627) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is (3Z)-3-[(5-tert-butyl-3,4-dihydropyridin-6-yl)methylidene]piperazine-2,5-dione.
| Compound Name | (3Z)-3-[(5-tert-butyl-3,4-dihydropyridin-6-yl)methylidene]piperazine-2,5-dione |
|---|---|
| PubChem CID | 163420627 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | (3Z)-3-[(5-tert-butyl-3,4-dihydropyridin-6-yl)methylidene]piperazine-2,5-dione |
| SMILES | CC(C)(C)C1=C(/C=C2\NC(=O)CNC2=O)N=CCC1 |
| InChI | InChI=1S/C14H19N3O2/c1-14(2,3)9-5-4-6-15-10(9)7-11-13(19)16-8-12(18)17-11/h6-7H,4-5,8H2,1-3H3,(H,16,19)(H,17,18)/b11-7- |
| InChIKey | AICTZTSYPKJFKN-XFFZJAGNSA-N |
| XLogP | 1.28 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|