C27H49NO — CID 161206358
1,2-ditert-butylcyclohexene;5,6-ditert-butyl-3,4-dihydro-1H-pyridin-2-one (PubChem CID 161206358) has the molecular formula C27H49NO and a molecular weight of 403.70 g/mol. Its IUPAC name is 1,2-ditert-butylcyclohexene;5,6-ditert-butyl-3,4-dihydro-1H-pyridin-2-one.
| Compound Name | 1,2-ditert-butylcyclohexene;5,6-ditert-butyl-3,4-dihydro-1H-pyridin-2-one |
|---|---|
| PubChem CID | 161206358 |
| Molecular Formula | C27H49NO |
| Molecular Weight | 403.70 g/mol |
| Exact Mass | 403.38 |
| IUPAC Name | 1,2-ditert-butylcyclohexene;5,6-ditert-butyl-3,4-dihydro-1H-pyridin-2-one |
| SMILES | CC(C)(C)C1=C(C(C)(C)C)CCCC1.CC(C)(C)C1=C(C(C)(C)C)NC(=O)CC1 |
| InChI | InChI=1S/C14H26.C13H23NO/c1-13(2,3)11-9-7-8-10-12(11)14(4,5)6;1-12(2,3)9-7-8-10(15)14-11(9)13(4,5)6/h7-10H2,1-6H3;7-8H2,1-6H3,(H,14,15) |
| InChIKey | UVQMACDWTDVFGH-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.70 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|