C10H16F6O3S — CID 163976086
(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl) 2-methylpentane-3-sulfonate (PubChem CID 163976086) has the molecular formula C10H16F6O3S and a molecular weight of 330.29 g/mol. Its IUPAC name is (1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl) 2-methylpentane-3-sulfonate.
| Compound Name | (1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl) 2-methylpentane-3-sulfonate |
|---|---|
| PubChem CID | 163976086 |
| Molecular Formula | C10H16F6O3S |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | (1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl) 2-methylpentane-3-sulfonate |
| SMILES | CCC(C(C)C)S(=O)(=O)OC(C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H16F6O3S/c1-5-7(6(2)3)20(17,18)19-8(4,9(11,12)13)10(14,15)16/h6-7H,5H2,1-4H3 |
| InChIKey | SUGLJIYRFCKZNM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|