C23H26N3O8P — CID 163977419
propan-2-yl 2-methyl-2-[[(5-nitroquinolin-8-yl)oxymethoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 163977419) has the molecular formula C23H26N3O8P and a molecular weight of 503.45 g/mol. Its IUPAC name is propan-2-yl 2-methyl-2-[[(5-nitroquinolin-8-yl)oxymethoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-methyl-2-[[(5-nitroquinolin-8-yl)oxymethoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 163977419 |
| Molecular Formula | C23H26N3O8P |
| Molecular Weight | 503.45 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | propan-2-yl 2-methyl-2-[[(5-nitroquinolin-8-yl)oxymethoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)C(C)(C)NP(=O)(OCOc1ccc([N+](=O)[O-])c2cccnc12)Oc1ccccc1 |
| InChI | InChI=1S/C23H26N3O8P/c1-16(2)33-22(27)23(3,4)25-35(30,34-17-9-6-5-7-10-17)32-15-31-20-13-12-19(26(28)29)18-11-8-14-24-21(18)20/h5-14,16H,15H2,1-4H3,(H,25,30) |
| InChIKey | SVJVZECWWJHBPH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.45 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|