About 7-sulfanylphenazine-2,3-diol
7-sulfanylphenazine-2,3-diol (PubChem CID 163978493) has the molecular formula C12H8N2O2S
and a molecular weight of 244.28 g/mol. Its IUPAC name is 7-sulfanylphenazine-2,3-diol.
Molecular Properties
| Compound Name | 7-sulfanylphenazine-2,3-diol |
| PubChem CID | 163978493 |
| Molecular Formula | C12H8N2O2S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 7-sulfanylphenazine-2,3-diol |
| SMILES | Oc1cc2nc3ccc(S)cc3nc2cc1O |
| InChI | InChI=1S/C12H8N2O2S/c15-11-4-9-10(5-12(11)16)14-8-3-6(17)1-2-7(8)13-9/h1-5,15-17H |
| InChIKey | SWGXUSLKMPUUCU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 7-sulfanylphenazine-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-sulfanylphenazine-2,3-diol?
The IUPAC name of 7-sulfanylphenazine-2,3-diol (CID 163978493) is 7-sulfanylphenazine-2,3-diol.
What is the SMILES notation for 7-sulfanylphenazine-2,3-diol?
The canonical SMILES for 7-sulfanylphenazine-2,3-diol is Oc1cc2nc3ccc(S)cc3nc2cc1O.
What is the InChIKey of 7-sulfanylphenazine-2,3-diol?
The InChIKey is SWGXUSLKMPUUCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O2S/c15-11-4-9-10(5-12(11)16)14-8-3-6(17)1-2-7(8)13-9/h1-5,15-17H.
What are the key properties of 7-sulfanylphenazine-2,3-diol?
7-sulfanylphenazine-2,3-diol has a molecular weight of 244.28 g/mol, XLogP of 2.48, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-sulfanylphenazine-2,3-diol is sourced from PubChem (CID 163978493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).