C25H29BN2O2 — CID 163981430
2-phenyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-1,5-dien-1-yl]-3a,7a-dihydrobenzimidazole (PubChem CID 163981430) has the molecular formula C25H29BN2O2 and a molecular weight of 400.33 g/mol. Its IUPAC name is 2-phenyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-1,5-dien-1-yl]-3a,7a-dihydrobenzimidazole.
| Compound Name | 2-phenyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-1,5-dien-1-yl]-3a,7a-dihydrobenzimidazole |
|---|---|
| PubChem CID | 163981430 |
| Molecular Formula | C25H29BN2O2 |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 2-phenyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-1,5-dien-1-yl]-3a,7a-dihydrobenzimidazole |
| SMILES | CC1(C)OB(C2C=CC(N3C(c4ccccc4)=NC4C=CC=CC43)=CC2)OC1(C)C |
| InChI | InChI=1S/C25H29BN2O2/c1-24(2)25(3,4)30-26(29-24)19-14-16-20(17-15-19)28-22-13-9-8-12-21(22)27-23(28)18-10-6-5-7-11-18/h5-14,16-17,19,21-22H,15H2,1-4H3 |
| InChIKey | SYSSUSTUDKBCEQ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|