C18H25BN2O2 — CID 144734432
4,6-dimethyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,4-dihydropyrimidine (PubChem CID 144734432) has the molecular formula C18H25BN2O2 and a molecular weight of 312.22 g/mol. Its IUPAC name is 4,6-dimethyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,4-dihydropyrimidine.
| Compound Name | 4,6-dimethyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 144734432 |
| Molecular Formula | C18H25BN2O2 |
| Molecular Weight | 312.22 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 4,6-dimethyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,4-dihydropyrimidine |
| SMILES | CC1=CC(C)N=C(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)N1 |
| InChI | InChI=1S/C18H25BN2O2/c1-12-11-13(2)21-16(20-12)14-7-9-15(10-8-14)19-22-17(3,4)18(5,6)23-19/h7-12H,1-6H3,(H,20,21) |
| InChIKey | DSQIOCBAOJWSOP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.22 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|