C28H29BN2O2 — CID 156901769
2,4-diphenyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-pyrimidine (PubChem CID 156901769) has the molecular formula C28H29BN2O2 and a molecular weight of 436.36 g/mol. Its IUPAC name is 2,4-diphenyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-pyrimidine.
| Compound Name | 2,4-diphenyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-pyrimidine |
|---|---|
| PubChem CID | 156901769 |
| Molecular Formula | C28H29BN2O2 |
| Molecular Weight | 436.36 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 2,4-diphenyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-pyrimidine |
| SMILES | CC1(C)OB(c2cccc(C3(c4ccccc4)C=CNC(c4ccccc4)=N3)c2)OC1(C)C |
| InChI | InChI=1S/C28H29BN2O2/c1-26(2)27(3,4)33-29(32-26)24-17-11-16-23(20-24)28(22-14-9-6-10-15-22)18-19-30-25(31-28)21-12-7-5-8-13-21/h5-20H,1-4H3,(H,30,31) |
| InChIKey | WXLSGMSVFIIEOM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.36 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|