C45H44BN3O2 — CID 163952062
4,6-bis(4-phenylphenyl)-2-[4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclohexa-1,5-dien-1-yl]-1,2,3,4-tetrahydro-1,3,5-triazine (PubChem CID 163952062) has the molecular formula C45H44BN3O2 and a molecular weight of 669.68 g/mol. Its IUPAC name is 4,6-bis(4-phenylphenyl)-2-[4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclohexa-1,5-dien-1-yl]-1,2,3,4-tetrahydro-1,3,5-triazine.
| Compound Name | 4,6-bis(4-phenylphenyl)-2-[4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclohexa-1,5-dien-1-yl]-1,2,3,4-tetrahydro-1,3,5-triazine |
|---|---|
| PubChem CID | 163952062 |
| Molecular Formula | C45H44BN3O2 |
| Molecular Weight | 669.68 g/mol |
| Exact Mass | 669.35 |
| IUPAC Name | 4,6-bis(4-phenylphenyl)-2-[4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclohexa-1,5-dien-1-yl]-1,2,3,4-tetrahydro-1,3,5-triazine |
| SMILES | CC1(C)OB(c2cccc(C3C=CC(C4NC(c5ccc(-c6ccccc6)cc5)=NC(c5ccc(-c6ccccc6)cc5)N4)=CC3)c2)OC1(C)C |
| InChI | InChI=1S/C45H44BN3O2/c1-44(2)45(3,4)51-46(50-44)40-17-11-16-39(30-40)35-22-28-38(29-23-35)43-48-41(36-24-18-33(19-25-36)31-12-7-5-8-13-31)47-42(49-43)37-26-20-34(21-27-37)32-14-9-6-10-15-32/h5-22,24-30,35,41,43,48H,23H2,1-4H3,(H,47,49) |
| InChIKey | SAEKPZFEFAKGAU-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.68 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|