C19H25BN2O2 — CID 137060310
N-benzyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,4-dihydroazepin-7-imine (PubChem CID 137060310) has the molecular formula C19H25BN2O2 and a molecular weight of 324.23 g/mol. Its IUPAC name is N-benzyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,4-dihydroazepin-7-imine.
| Compound Name | N-benzyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,4-dihydroazepin-7-imine |
|---|---|
| PubChem CID | 137060310 |
| Molecular Formula | C19H25BN2O2 |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | N-benzyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,4-dihydroazepin-7-imine |
| SMILES | CC1(C)OB(C2C=CN/C(=N/Cc3ccccc3)C=C2)OC1(C)C |
| InChI | InChI=1S/C19H25BN2O2/c1-18(2)19(3,4)24-20(23-18)16-10-11-17(21-13-12-16)22-14-15-8-6-5-7-9-15/h5-13,16H,14H2,1-4H3,(H,21,22) |
| InChIKey | JLAZUAAMVZHISV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|