C17H21BF3N3O2 — CID 67258753
4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-(trifluoromethyl)-1H-pyrimidin-2-amine (PubChem CID 67258753) has the molecular formula C17H21BF3N3O2 and a molecular weight of 367.18 g/mol. Its IUPAC name is 4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-(trifluoromethyl)-1H-pyrimidin-2-amine.
| Compound Name | 4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-(trifluoromethyl)-1H-pyrimidin-2-amine |
|---|---|
| PubChem CID | 67258753 |
| Molecular Formula | C17H21BF3N3O2 |
| Molecular Weight | 367.18 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-(trifluoromethyl)-1H-pyrimidin-2-amine |
| SMILES | CC1(C)OB(c2cccc(C3(C(F)(F)F)C=CNC(N)=N3)c2)OC1(C)C |
| InChI | InChI=1S/C17H21BF3N3O2/c1-14(2)15(3,4)26-18(25-14)12-7-5-6-11(10-12)16(17(19,20)21)8-9-23-13(22)24-16/h5-10H,1-4H3,(H3,22,23,24) |
| InChIKey | NRUPGZSOLZMXLO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.18 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|