C23H44N2O4 — CID 163981731
[2-methyl-6-(2-methyl-4-oxobutan-2-yl)oxyhexan-2-yl] N-[(5-amino-1,3,3-trimethylcyclohexyl)methyl]carbamate (PubChem CID 163981731) has the molecular formula C23H44N2O4 and a molecular weight of 412.62 g/mol. Its IUPAC name is [2-methyl-6-(2-methyl-4-oxobutan-2-yl)oxyhexan-2-yl] N-[(5-amino-1,3,3-trimethylcyclohexyl)methyl]carbamate.
| Compound Name | [2-methyl-6-(2-methyl-4-oxobutan-2-yl)oxyhexan-2-yl] N-[(5-amino-1,3,3-trimethylcyclohexyl)methyl]carbamate |
|---|---|
| PubChem CID | 163981731 |
| Molecular Formula | C23H44N2O4 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.33 |
| IUPAC Name | [2-methyl-6-(2-methyl-4-oxobutan-2-yl)oxyhexan-2-yl] N-[(5-amino-1,3,3-trimethylcyclohexyl)methyl]carbamate |
| SMILES | CC1(C)CC(N)CC(C)(CNC(=O)OC(C)(C)CCCCOC(C)(C)CC=O)C1 |
| InChI | InChI=1S/C23H44N2O4/c1-20(2)14-18(24)15-23(7,16-20)17-25-19(27)29-22(5,6)10-8-9-13-28-21(3,4)11-12-26/h12,18H,8-11,13-17,24H2,1-7H3,(H,25,27) |
| InChIKey | SYZMRVCLKTUJDI-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|