C13H26N2O2 — CID 56842384
3-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]propanoic acid (PubChem CID 56842384) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 3-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]propanoic acid.
| Compound Name | 3-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 56842384 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 3-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]propanoic acid |
| SMILES | CC1(C)CC(N)CC(C)(CNCCC(=O)O)C1 |
| InChI | InChI=1S/C13H26N2O2/c1-12(2)6-10(14)7-13(3,8-12)9-15-5-4-11(16)17/h10,15H,4-9,14H2,1-3H3,(H,16,17) |
| InChIKey | RGKAWYALXRQNJW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|