C20H25N7S — CID 163983811
12-[(1S,2R,4S)-4-[[(E)-cyclopropyl(ethylidene)-λ4-sulfanyl]amino]-2-ethylcyclopentyl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene-3-carbonitrile (PubChem CID 163983811) has the molecular formula C20H25N7S and a molecular weight of 395.54 g/mol. Its IUPAC name is 12-[(1S,2R,4S)-4-[[(E)-cyclopropyl(ethylidene)-λ4-sulfanyl]amino]-2-ethylcyclopentyl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene-3-carbonitrile.
| Compound Name | 12-[(1S,2R,4S)-4-[[(E)-cyclopropyl(ethylidene)-λ4-sulfanyl]amino]-2-ethylcyclopentyl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene-3-carbonitrile |
|---|---|
| PubChem CID | 163983811 |
| Molecular Formula | C20H25N7S |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 12-[(1S,2R,4S)-4-[[(E)-cyclopropyl(ethylidene)-λ4-sulfanyl]amino]-2-ethylcyclopentyl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene-3-carbonitrile |
| SMILES | C/C=S(/N[C@H]1C[C@@H](CC)[C@@H](c2nnc3cnc4[nH]cc(C#N)c4n23)C1)C1CC1 |
| InChI | InChI=1S/C20H25N7S/c1-3-12-7-14(26-28(4-2)15-5-6-15)8-16(12)20-25-24-17-11-23-19-18(27(17)20)13(9-21)10-22-19/h4,10-12,14-16,22,26H,3,5-8H2,1-2H3/t12-,14+,16+,28?/m1/s1 |
| InChIKey | TUODQBDVOWKPRL-ZQZCUKBMSA-N |
| XLogP | 3.51 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|