C7H18N4O — CID 163985535
3,7-dihydrazinylheptan-2-one (PubChem CID 163985535) has the molecular formula C7H18N4O and a molecular weight of 174.25 g/mol. Its IUPAC name is 3,7-dihydrazinylheptan-2-one.
| Compound Name | 3,7-dihydrazinylheptan-2-one |
|---|---|
| PubChem CID | 163985535 |
| Molecular Formula | C7H18N4O |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.15 |
| IUPAC Name | 3,7-dihydrazinylheptan-2-one |
| SMILES | CC(=O)C(CCCCNN)NN |
| InChI | InChI=1S/C7H18N4O/c1-6(12)7(11-9)4-2-3-5-10-8/h7,10-11H,2-5,8-9H2,1H3 |
| InChIKey | TVYVOLHUFNNMFA-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|