C36H23NO8 — CID 163989460
9-(5H-benzo[b]carbazol-3-yl)-10-phenylanthracene-1,2,3,4,5,6,7,8-octol (PubChem CID 163989460) has the molecular formula C36H23NO8 and a molecular weight of 597.58 g/mol. Its IUPAC name is 9-(5H-benzo[b]carbazol-3-yl)-10-phenylanthracene-1,2,3,4,5,6,7,8-octol.
| Compound Name | 9-(5H-benzo[b]carbazol-3-yl)-10-phenylanthracene-1,2,3,4,5,6,7,8-octol |
|---|---|
| PubChem CID | 163989460 |
| Molecular Formula | C36H23NO8 |
| Molecular Weight | 597.58 g/mol |
| Exact Mass | 597.14 |
| IUPAC Name | 9-(5H-benzo[b]carbazol-3-yl)-10-phenylanthracene-1,2,3,4,5,6,7,8-octol |
| SMILES | Oc1c(O)c(O)c2c(-c3ccc4c(c3)[nH]c3cc5ccccc5cc34)c3c(O)c(O)c(O)c(O)c3c(-c3ccccc3)c2c1O |
| InChI | InChI=1S/C36H23NO8/c38-29-25-23(15-6-2-1-3-7-15)26-28(32(41)36(45)34(43)30(26)39)24(27(25)31(40)35(44)33(29)42)18-10-11-19-20-12-16-8-4-5-9-17(16)13-22(20)37-21(19)14-18/h1-14,37-45H |
| InChIKey | TZHYZWUCPVKGJL-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 177.63 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.58 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|