C12H18FN4O12P3 — CID 163989979
[(1R,3S,4S,5S)-3-(4-amino-1,2-dihydropyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-5-hydroxy-4-methyl-2-oxabicyclo[3.1.0]hexan-6-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate (PubChem CID 163989979) has the molecular formula C12H18FN4O12P3 and a molecular weight of 522.21 g/mol. Its IUPAC name is [(1R,3S,4S,5S)-3-(4-amino-1,2-dihydropyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-5-hydroxy-4-methyl-2-oxabicyclo[3.1.0]hexan-6-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate.
| Compound Name | [(1R,3S,4S,5S)-3-(4-amino-1,2-dihydropyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-5-hydroxy-4-methyl-2-oxabicyclo[3.1.0]hexan-6-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 163989979 |
| Molecular Formula | C12H18FN4O12P3 |
| Molecular Weight | 522.21 g/mol |
| Exact Mass | 522.01 |
| IUPAC Name | [(1R,3S,4S,5S)-3-(4-amino-1,2-dihydropyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-5-hydroxy-4-methyl-2-oxabicyclo[3.1.0]hexan-6-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
| SMILES | C[C@]1(F)[C@H](c2ccc3n2NCN=C3N)O[C@@H]2C(OP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@]21O |
| InChI | InChI=1S/C12H18FN4O12P3/c1-11(13)7(5-2-3-6-10(14)15-4-16-17(5)6)26-8-9(12(8,11)18)27-31(22,23)29-32(24,25)28-30(19,20)21/h2-3,7-9,16,18H,4H2,1H3,(H2,14,15)(H,22,23)(H,24,25)(H2,19,20,21)/t7-,8+,9?,11-,12-/m0/s1 |
| InChIKey | TZTCDSJXHLZPTF-NOJMPOHWSA-N |
| XLogP | -0.67 |
| TPSA | 244.62 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.21 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|