C11H15N4O14P3 — CID 138721496
[(1R,3R,4R,5R)-3-(4-amino-2-oxopyrimidin-1-yl)-3-cyano-4,5-dihydroxy-4-methyl-2-oxabicyclo[3.1.0]hexan-6-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate (PubChem CID 138721496) has the molecular formula C11H15N4O14P3 and a molecular weight of 520.18 g/mol. Its IUPAC name is [(1R,3R,4R,5R)-3-(4-amino-2-oxopyrimidin-1-yl)-3-cyano-4,5-dihydroxy-4-methyl-2-oxabicyclo[3.1.0]hexan-6-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate.
| Compound Name | [(1R,3R,4R,5R)-3-(4-amino-2-oxopyrimidin-1-yl)-3-cyano-4,5-dihydroxy-4-methyl-2-oxabicyclo[3.1.0]hexan-6-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 138721496 |
| Molecular Formula | C11H15N4O14P3 |
| Molecular Weight | 520.18 g/mol |
| Exact Mass | 519.98 |
| IUPAC Name | [(1R,3R,4R,5R)-3-(4-amino-2-oxopyrimidin-1-yl)-3-cyano-4,5-dihydroxy-4-methyl-2-oxabicyclo[3.1.0]hexan-6-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
| SMILES | C[C@]1(O)[C@](C#N)(n2ccc(N)nc2=O)O[C@@H]2C(OP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@]21O |
| InChI | InChI=1S/C11H15N4O14P3/c1-9(17)10(4-12,15-3-2-5(13)14-8(15)16)26-6-7(11(6,9)18)27-31(22,23)29-32(24,25)28-30(19,20)21/h2-3,6-7,17-18H,1H3,(H,22,23)(H,24,25)(H2,13,14,16)(H2,19,20,21)/t6-,7?,9+,10-,11-/m1/s1 |
| InChIKey | BHRQKAXWMRHDPV-QVANZXJISA-N |
| XLogP | -2.39 |
| TPSA | 294.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.18 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|