C19H22N2O8 — CID 163995247
2-[[2-ethoxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-methoxymethylidene]propanedinitrile (PubChem CID 163995247) has the molecular formula C19H22N2O8 and a molecular weight of 406.39 g/mol. Its IUPAC name is 2-[[2-ethoxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-methoxymethylidene]propanedinitrile.
| Compound Name | 2-[[2-ethoxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-methoxymethylidene]propanedinitrile |
|---|---|
| PubChem CID | 163995247 |
| Molecular Formula | C19H22N2O8 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 2-[[2-ethoxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-methoxymethylidene]propanedinitrile |
| SMILES | CCOc1cc(OC2OC(CO)C(O)C(O)C2O)ccc1C(OC)=C(C#N)C#N |
| InChI | InChI=1S/C19H22N2O8/c1-3-27-13-6-11(4-5-12(13)18(26-2)10(7-20)8-21)28-19-17(25)16(24)15(23)14(9-22)29-19/h4-6,14-17,19,22-25H,3,9H2,1-2H3 |
| InChIKey | UECXLFYAWOFLAV-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 165.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|