C11H15F3 — CID 163997732
6-(1,1,1-trifluoropropan-2-yl)bicyclo[3.2.1]oct-2-ene (PubChem CID 163997732) has the molecular formula C11H15F3 and a molecular weight of 204.23 g/mol. Its IUPAC name is 6-(1,1,1-trifluoropropan-2-yl)bicyclo[3.2.1]oct-2-ene.
| Compound Name | 6-(1,1,1-trifluoropropan-2-yl)bicyclo[3.2.1]oct-2-ene |
|---|---|
| PubChem CID | 163997732 |
| Molecular Formula | C11H15F3 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 6-(1,1,1-trifluoropropan-2-yl)bicyclo[3.2.1]oct-2-ene |
| SMILES | CC(C1CC2C=CCC1C2)C(F)(F)F |
| InChI | InChI=1S/C11H15F3/c1-7(11(12,13)14)10-6-8-3-2-4-9(10)5-8/h2-3,7-10H,4-6H2,1H3 |
| InChIKey | UGEOJZQDKYECDR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|