C19H21N5O — CID 164517172
1-[1-(4-butylphenyl)-2-hydroxyindol-3-yl]iminoguanidine (PubChem CID 164517172) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is 1-[1-(4-butylphenyl)-2-hydroxyindol-3-yl]iminoguanidine.
| Compound Name | 1-[1-(4-butylphenyl)-2-hydroxyindol-3-yl]iminoguanidine |
|---|---|
| PubChem CID | 164517172 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 1-[1-(4-butylphenyl)-2-hydroxyindol-3-yl]iminoguanidine |
| SMILES | [H]/N=C(N)/N=N/c1c(O)n(-c2ccc(CCCC)cc2)c2ccccc12 |
| InChI | InChI=1S/C19H21N5O/c1-2-3-6-13-9-11-14(12-10-13)24-16-8-5-4-7-15(16)17(18(24)25)22-23-19(20)21/h4-5,7-12,25H,2-3,6H2,1H3,(H3,20,21)/b23-22+ |
| InChIKey | DKTBRHYMPNQIJP-GHVJWSGMSA-N |
| XLogP | 4.66 |
| TPSA | 99.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|