C23H32O4 — CID 164522854
ethyl 2-[(1R,5R,6R,8aS)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]benzoate (PubChem CID 164522854) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is ethyl 2-[(1R,5R,6R,8aS)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]benzoate.
| Compound Name | ethyl 2-[(1R,5R,6R,8aS)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]benzoate |
|---|---|
| PubChem CID | 164522854 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | ethyl 2-[(1R,5R,6R,8aS)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]benzoate |
| SMILES | C=C1CCC2[C@](C)(CO)[C@H](O)CC[C@]2(C)[C@@H]1c1ccccc1C(=O)OCC |
| InChI | InChI=1S/C23H32O4/c1-5-27-21(26)17-9-7-6-8-16(17)20-15(2)10-11-18-22(20,3)13-12-19(25)23(18,4)14-24/h6-9,18-20,24-25H,2,5,10-14H2,1,3-4H3/t18?,19-,20+,22+,23+/m1/s1 |
| InChIKey | ZBPNFWNQTZSDKO-FRHXUFQCSA-N |
| XLogP | 4.07 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|