C18H25N5O4 — CID 164529916
tert-butyl N-[1-[2-amino-5-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]piperidin-4-yl]carbamate (PubChem CID 164529916) has the molecular formula C18H25N5O4 and a molecular weight of 375.43 g/mol. Its IUPAC name is tert-butyl N-[1-[2-amino-5-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-amino-5-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 164529916 |
| Molecular Formula | C18H25N5O4 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | tert-butyl N-[1-[2-amino-5-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(c2cc(-c3noc(=O)[nH]3)ccc2N)CC1 |
| InChI | InChI=1S/C18H25N5O4/c1-18(2,3)26-16(24)20-12-6-8-23(9-7-12)14-10-11(4-5-13(14)19)15-21-17(25)27-22-15/h4-5,10,12H,6-9,19H2,1-3H3,(H,20,24)(H,21,22,25) |
| InChIKey | YLJKFVJRGAQULJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|