C35H40FN5O5S — CID 164534434
N-[(1,1-dioxothietan-3-yl)methyl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-[8-(oxan-2-yloxymethyl)naphthalen-1-yl]pyrido[4,3-d]pyrimidin-4-amine (PubChem CID 164534434) has the molecular formula C35H40FN5O5S and a molecular weight of 661.80 g/mol. Its IUPAC name is N-[(1,1-dioxothietan-3-yl)methyl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-[8-(oxan-2-yloxymethyl)naphthalen-1-yl]pyrido[4,3-d]pyrimidin-4-amine.
| Compound Name | N-[(1,1-dioxothietan-3-yl)methyl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-[8-(oxan-2-yloxymethyl)naphthalen-1-yl]pyrido[4,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 164534434 |
| Molecular Formula | C35H40FN5O5S |
| Molecular Weight | 661.80 g/mol |
| Exact Mass | 661.27 |
| IUPAC Name | N-[(1,1-dioxothietan-3-yl)methyl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-[8-(oxan-2-yloxymethyl)naphthalen-1-yl]pyrido[4,3-d]pyrimidin-4-amine |
| SMILES | O=S1(=O)CC(CNc2nc(OCC34CCCN3CCC4)nc3c(F)c(-c4cccc5cccc(COC6CCCCO6)c45)ncc23)C1 |
| InChI | InChI=1S/C35H40FN5O5S/c36-30-31(26-10-4-8-24-7-3-9-25(29(24)26)19-45-28-11-1-2-16-44-28)37-18-27-32(30)39-34(40-33(27)38-17-23-20-47(42,43)21-23)46-22-35-12-5-14-41(35)15-6-13-35/h3-4,7-10,18,23,28H,1-2,5-6,11-17,19-22H2,(H,38,39,40) |
| InChIKey | TWNZLZODZYIHRL-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.80 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |