C21H22ClF2N7O — CID 164535283
N-[(2-amino-3-pyridinyl)methyl]-7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-amine (PubChem CID 164535283) has the molecular formula C21H22ClF2N7O and a molecular weight of 461.90 g/mol. Its IUPAC name is N-[(2-amino-3-pyridinyl)methyl]-7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-amine.
| Compound Name | N-[(2-amino-3-pyridinyl)methyl]-7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 164535283 |
| Molecular Formula | C21H22ClF2N7O |
| Molecular Weight | 461.90 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | N-[(2-amino-3-pyridinyl)methyl]-7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-amine |
| SMILES | Nc1ncccc1CNc1nc(OC[C@@]23CCCN2C[C@H](F)C3)nc2c(F)c(Cl)ncc12 |
| InChI | InChI=1S/C21H22ClF2N7O/c22-17-15(24)16-14(9-27-17)19(28-8-12-3-1-5-26-18(12)25)30-20(29-16)32-11-21-4-2-6-31(21)10-13(23)7-21/h1,3,5,9,13H,2,4,6-8,10-11H2,(H2,25,26)(H,28,29,30)/t13-,21+/m1/s1 |
| InChIKey | CJZCZHFAIDWQOJ-ASSNKEHSSA-N |
| XLogP | 3.36 |
| TPSA | 102.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.90 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|