C19H30N3+ — CID 164541106
3-[2-[di(propan-2-yl)amino]ethyl]-1,1-dimethyl-3a,7a-dihydroindol-1-ium-4-carbonitrile (PubChem CID 164541106) has the molecular formula C19H30N3+ and a molecular weight of 300.47 g/mol. Its IUPAC name is 3-[2-[di(propan-2-yl)amino]ethyl]-1,1-dimethyl-3a,7a-dihydroindol-1-ium-4-carbonitrile.
| Compound Name | 3-[2-[di(propan-2-yl)amino]ethyl]-1,1-dimethyl-3a,7a-dihydroindol-1-ium-4-carbonitrile |
|---|---|
| PubChem CID | 164541106 |
| Molecular Formula | C19H30N3+ |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.24 |
| IUPAC Name | 3-[2-[di(propan-2-yl)amino]ethyl]-1,1-dimethyl-3a,7a-dihydroindol-1-ium-4-carbonitrile |
| SMILES | CC(C)N(CCC1=C[N+](C)(C)C2C=CC=C(C#N)C12)C(C)C |
| InChI | InChI=1S/C19H30N3/c1-14(2)21(15(3)4)11-10-17-13-22(5,6)18-9-7-8-16(12-20)19(17)18/h7-9,13-15,18-19H,10-11H2,1-6H3/q+1 |
| InChIKey | PQEZUWVYZICTRU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|