C17H21BrN4O4 — CID 164542939
methyl 4-[[(E)-1-amino-2-carbamoyl-3-[[(3R)-oxan-3-yl]amino]prop-2-enylidene]amino]-2-bromobenzoate (PubChem CID 164542939) has the molecular formula C17H21BrN4O4 and a molecular weight of 425.28 g/mol. Its IUPAC name is methyl 4-[[(E)-1-amino-2-carbamoyl-3-[[(3R)-oxan-3-yl]amino]prop-2-enylidene]amino]-2-bromobenzoate.
| Compound Name | methyl 4-[[(E)-1-amino-2-carbamoyl-3-[[(3R)-oxan-3-yl]amino]prop-2-enylidene]amino]-2-bromobenzoate |
|---|---|
| PubChem CID | 164542939 |
| Molecular Formula | C17H21BrN4O4 |
| Molecular Weight | 425.28 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | methyl 4-[[(E)-1-amino-2-carbamoyl-3-[[(3R)-oxan-3-yl]amino]prop-2-enylidene]amino]-2-bromobenzoate |
| SMILES | COC(=O)c1ccc(/N=C(N)/C(=C\N[C@@H]2CCCOC2)C(N)=O)cc1Br |
| InChI | InChI=1S/C17H21BrN4O4/c1-25-17(24)12-5-4-10(7-14(12)18)22-15(19)13(16(20)23)8-21-11-3-2-6-26-9-11/h4-5,7-8,11,21H,2-3,6,9H2,1H3,(H2,19,22)(H2,20,23)/b13-8+/t11-/m1/s1 |
| InChIKey | BTXGRWYVHNUYMX-KAQJVSAMSA-N |
| XLogP | 1.36 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|