C19H22F3N5O2 — CID 137176738
(E)-3-[(2-cyanocyclohexyl)amino]-2-[N'-[4-(2,2,2-trifluoro-1-hydroxyethyl)phenyl]carbamimidoyl]prop-2-enamide (PubChem CID 137176738) has the molecular formula C19H22F3N5O2 and a molecular weight of 409.41 g/mol. Its IUPAC name is (E)-3-[(2-cyanocyclohexyl)amino]-2-[N'-[4-(2,2,2-trifluoro-1-hydroxyethyl)phenyl]carbamimidoyl]prop-2-enamide.
| Compound Name | (E)-3-[(2-cyanocyclohexyl)amino]-2-[N'-[4-(2,2,2-trifluoro-1-hydroxyethyl)phenyl]carbamimidoyl]prop-2-enamide |
|---|---|
| PubChem CID | 137176738 |
| Molecular Formula | C19H22F3N5O2 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | (E)-3-[(2-cyanocyclohexyl)amino]-2-[N'-[4-(2,2,2-trifluoro-1-hydroxyethyl)phenyl]carbamimidoyl]prop-2-enamide |
| SMILES | N#CC1CCCCC1N/C=C(C(N)=O)\C(N)=N\c1ccc(C(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H22F3N5O2/c20-19(21,22)16(28)11-5-7-13(8-6-11)27-17(24)14(18(25)29)10-26-15-4-2-1-3-12(15)9-23/h5-8,10,12,15-16,26,28H,1-4H2,(H2,24,27)(H2,25,29)/b14-10+ |
| InChIKey | FKZOUNABMSVLNE-GXDHUFHOSA-N |
| XLogP | 2.31 |
| TPSA | 137.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|