C21H27F3N6O5S2 — CID 144556433
(E)-3-[[(1S,2S)-2-cyano-4-(2-methylsulfonylethylamino)cyclohexyl]amino]-2-[N'-[4-(trifluoromethylsulfonyl)phenyl]carbamimidoyl]prop-2-enamide (PubChem CID 144556433) has the molecular formula C21H27F3N6O5S2 and a molecular weight of 564.61 g/mol. Its IUPAC name is (E)-3-[[(1S,2S)-2-cyano-4-(2-methylsulfonylethylamino)cyclohexyl]amino]-2-[N'-[4-(trifluoromethylsulfonyl)phenyl]carbamimidoyl]prop-2-enamide.
| Compound Name | (E)-3-[[(1S,2S)-2-cyano-4-(2-methylsulfonylethylamino)cyclohexyl]amino]-2-[N'-[4-(trifluoromethylsulfonyl)phenyl]carbamimidoyl]prop-2-enamide |
|---|---|
| PubChem CID | 144556433 |
| Molecular Formula | C21H27F3N6O5S2 |
| Molecular Weight | 564.61 g/mol |
| Exact Mass | 564.14 |
| IUPAC Name | (E)-3-[[(1S,2S)-2-cyano-4-(2-methylsulfonylethylamino)cyclohexyl]amino]-2-[N'-[4-(trifluoromethylsulfonyl)phenyl]carbamimidoyl]prop-2-enamide |
| SMILES | CS(=O)(=O)CCNC1CC[C@H](N/C=C(C(N)=O)\C(N)=N\c2ccc(S(=O)(=O)C(F)(F)F)cc2)[C@@H](C#N)C1 |
| InChI | InChI=1S/C21H27F3N6O5S2/c1-36(32,33)9-8-28-15-4-7-18(13(10-15)11-25)29-12-17(20(27)31)19(26)30-14-2-5-16(6-3-14)37(34,35)21(22,23)24/h2-3,5-6,12-13,15,18,28-29H,4,7-10H2,1H3,(H2,26,30)(H2,27,31)/b17-12+/t13-,15?,18+/m1/s1 |
| InChIKey | ZQHQNKJTXMHWCC-BILFRPBXSA-N |
| XLogP | 0.62 |
| TPSA | 197.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.61 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|