C23H29F3N6O3S — CID 144556257
(E)-3-[[(1S,2S,4S)-2-cyano-4-[[(1R)-1-cyclopropylethyl]amino]cyclohexyl]amino]-2-[N'-[4-(trifluoromethylsulfonyl)phenyl]carbamimidoyl]prop-2-enamide (PubChem CID 144556257) has the molecular formula C23H29F3N6O3S and a molecular weight of 526.59 g/mol. Its IUPAC name is (E)-3-[[(1S,2S,4S)-2-cyano-4-[[(1R)-1-cyclopropylethyl]amino]cyclohexyl]amino]-2-[N'-[4-(trifluoromethylsulfonyl)phenyl]carbamimidoyl]prop-2-enamide.
| Compound Name | (E)-3-[[(1S,2S,4S)-2-cyano-4-[[(1R)-1-cyclopropylethyl]amino]cyclohexyl]amino]-2-[N'-[4-(trifluoromethylsulfonyl)phenyl]carbamimidoyl]prop-2-enamide |
|---|---|
| PubChem CID | 144556257 |
| Molecular Formula | C23H29F3N6O3S |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | (E)-3-[[(1S,2S,4S)-2-cyano-4-[[(1R)-1-cyclopropylethyl]amino]cyclohexyl]amino]-2-[N'-[4-(trifluoromethylsulfonyl)phenyl]carbamimidoyl]prop-2-enamide |
| SMILES | C[C@@H](N[C@H]1CC[C@H](N/C=C(C(N)=O)\C(N)=N\c2ccc(S(=O)(=O)C(F)(F)F)cc2)[C@@H](C#N)C1)C1CC1 |
| InChI | InChI=1S/C23H29F3N6O3S/c1-13(14-2-3-14)31-17-6-9-20(15(10-17)11-27)30-12-19(22(29)33)21(28)32-16-4-7-18(8-5-16)36(34,35)23(24,25)26/h4-5,7-8,12-15,17,20,30-31H,2-3,6,9-10H2,1H3,(H2,28,32)(H2,29,33)/b19-12+/t13-,15-,17+,20+/m1/s1 |
| InChIKey | RHNXCKKVSDUCCL-COXNDNMOSA-N |
| XLogP | 2.38 |
| TPSA | 163.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|