C22H27F3N6O5S2 — CID 123160846
3-amino-2-[[2-cyano-4-[(1,1-dioxothiolan-3-yl)amino]cyclohexyl]iminomethyl]-3-[4-(trifluoromethylsulfonyl)phenyl]iminopropanamide (PubChem CID 123160846) has the molecular formula C22H27F3N6O5S2 and a molecular weight of 576.62 g/mol. Its IUPAC name is 3-amino-2-[[2-cyano-4-[(1,1-dioxothiolan-3-yl)amino]cyclohexyl]iminomethyl]-3-[4-(trifluoromethylsulfonyl)phenyl]iminopropanamide.
| Compound Name | 3-amino-2-[[2-cyano-4-[(1,1-dioxothiolan-3-yl)amino]cyclohexyl]iminomethyl]-3-[4-(trifluoromethylsulfonyl)phenyl]iminopropanamide |
|---|---|
| PubChem CID | 123160846 |
| Molecular Formula | C22H27F3N6O5S2 |
| Molecular Weight | 576.62 g/mol |
| Exact Mass | 576.14 |
| IUPAC Name | 3-amino-2-[[2-cyano-4-[(1,1-dioxothiolan-3-yl)amino]cyclohexyl]iminomethyl]-3-[4-(trifluoromethylsulfonyl)phenyl]iminopropanamide |
| SMILES | N#CC1CC(NC2CCS(=O)(=O)C2)CCC1/N=C/C(C(N)=O)/C(N)=N/c1ccc(S(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H27F3N6O5S2/c23-22(24,25)38(35,36)17-4-1-14(2-5-17)31-20(27)18(21(28)32)11-29-19-6-3-15(9-13(19)10-26)30-16-7-8-37(33,34)12-16/h1-2,4-5,11,13,15-16,18-19,30H,3,6-9,12H2,(H2,27,31)(H2,28,32)/b29-11+ |
| InChIKey | XKILNNGXLIECIG-VPUKRXIYSA-N |
| XLogP | 0.98 |
| TPSA | 197.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.62 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|