C26H33F3N6O — CID 137176879
(E)-3-[[(1R,4S)-2-cyano-4-(spiro[3.4]octan-2-ylamino)cyclohexyl]amino]-2-[N'-[4-(trifluoromethyl)phenyl]carbamimidoyl]prop-2-enamide (PubChem CID 137176879) has the molecular formula C26H33F3N6O and a molecular weight of 502.59 g/mol. Its IUPAC name is (E)-3-[[(1R,4S)-2-cyano-4-(spiro[3.4]octan-2-ylamino)cyclohexyl]amino]-2-[N'-[4-(trifluoromethyl)phenyl]carbamimidoyl]prop-2-enamide.
| Compound Name | (E)-3-[[(1R,4S)-2-cyano-4-(spiro[3.4]octan-2-ylamino)cyclohexyl]amino]-2-[N'-[4-(trifluoromethyl)phenyl]carbamimidoyl]prop-2-enamide |
|---|---|
| PubChem CID | 137176879 |
| Molecular Formula | C26H33F3N6O |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | (E)-3-[[(1R,4S)-2-cyano-4-(spiro[3.4]octan-2-ylamino)cyclohexyl]amino]-2-[N'-[4-(trifluoromethyl)phenyl]carbamimidoyl]prop-2-enamide |
| SMILES | N#CC1C[C@@H](NC2CC3(CCCC3)C2)CC[C@H]1N/C=C(C(N)=O)\C(N)=N\c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H33F3N6O/c27-26(28,29)17-3-5-18(6-4-17)35-23(31)21(24(32)36)15-33-22-8-7-19(11-16(22)14-30)34-20-12-25(13-20)9-1-2-10-25/h3-6,15-16,19-20,22,33-34H,1-2,7-13H2,(H2,31,35)(H2,32,36)/b21-15+/t16?,19-,22+/m0/s1 |
| InChIKey | AHSMXQSQYNYDBG-IIFMZOBASA-N |
| XLogP | 4.03 |
| TPSA | 129.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|