C20H27FN6O2 — CID 137307630
(E)-3-[[1-(cyanomethyl)-4-(2-hydroxyethylamino)cyclohexyl]amino]-2-[N'-(4-fluorophenyl)carbamimidoyl]prop-2-enamide (PubChem CID 137307630) has the molecular formula C20H27FN6O2 and a molecular weight of 402.47 g/mol. Its IUPAC name is (E)-3-[[1-(cyanomethyl)-4-(2-hydroxyethylamino)cyclohexyl]amino]-2-[N'-(4-fluorophenyl)carbamimidoyl]prop-2-enamide.
| Compound Name | (E)-3-[[1-(cyanomethyl)-4-(2-hydroxyethylamino)cyclohexyl]amino]-2-[N'-(4-fluorophenyl)carbamimidoyl]prop-2-enamide |
|---|---|
| PubChem CID | 137307630 |
| Molecular Formula | C20H27FN6O2 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | (E)-3-[[1-(cyanomethyl)-4-(2-hydroxyethylamino)cyclohexyl]amino]-2-[N'-(4-fluorophenyl)carbamimidoyl]prop-2-enamide |
| SMILES | N#CCC1(N/C=C(C(N)=O)\C(N)=N\c2ccc(F)cc2)CCC(NCCO)CC1 |
| InChI | InChI=1S/C20H27FN6O2/c21-14-1-3-16(4-2-14)27-18(23)17(19(24)29)13-26-20(9-10-22)7-5-15(6-8-20)25-11-12-28/h1-4,13,15,25-26,28H,5-9,11-12H2,(H2,23,27)(H2,24,29)/b17-13+ |
| InChIKey | CBXJFKOTGHODGK-GHRIWEEISA-N |
| XLogP | 0.95 |
| TPSA | 149.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|