C19H23F4N7O — CID 137307734
(E)-3-[[1-(cyanomethyl)-4-(2,2,2-trifluoroethylamino)cyclohexyl]amino]-2-[N'-(2-fluoro-4-pyridinyl)carbamimidoyl]prop-2-enamide (PubChem CID 137307734) has the molecular formula C19H23F4N7O and a molecular weight of 441.43 g/mol. Its IUPAC name is (E)-3-[[1-(cyanomethyl)-4-(2,2,2-trifluoroethylamino)cyclohexyl]amino]-2-[N'-(2-fluoro-4-pyridinyl)carbamimidoyl]prop-2-enamide.
| Compound Name | (E)-3-[[1-(cyanomethyl)-4-(2,2,2-trifluoroethylamino)cyclohexyl]amino]-2-[N'-(2-fluoro-4-pyridinyl)carbamimidoyl]prop-2-enamide |
|---|---|
| PubChem CID | 137307734 |
| Molecular Formula | C19H23F4N7O |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | (E)-3-[[1-(cyanomethyl)-4-(2,2,2-trifluoroethylamino)cyclohexyl]amino]-2-[N'-(2-fluoro-4-pyridinyl)carbamimidoyl]prop-2-enamide |
| SMILES | N#CCC1(N/C=C(C(N)=O)\C(N)=N\c2ccnc(F)c2)CCC(NCC(F)(F)F)CC1 |
| InChI | InChI=1S/C19H23F4N7O/c20-15-9-13(3-8-27-15)30-16(25)14(17(26)31)10-29-18(6-7-24)4-1-12(2-5-18)28-11-19(21,22)23/h3,8-10,12,28-29H,1-2,4-6,11H2,(H2,26,31)(H2,25,27,30)/b14-10+ |
| InChIKey | UPXIIUQUOGZQCQ-GXDHUFHOSA-N |
| XLogP | 1.92 |
| TPSA | 142.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|