C22H28FN7O2 — CID 137307713
(E)-3-[[4-(aminomethyl)-1-[(4-hydroxyphenyl)methyl]piperidin-4-yl]amino]-2-[N'-(2-fluoro-4-pyridinyl)carbamimidoyl]prop-2-enamide (PubChem CID 137307713) has the molecular formula C22H28FN7O2 and a molecular weight of 441.51 g/mol. Its IUPAC name is (E)-3-[[4-(aminomethyl)-1-[(4-hydroxyphenyl)methyl]piperidin-4-yl]amino]-2-[N'-(2-fluoro-4-pyridinyl)carbamimidoyl]prop-2-enamide.
| Compound Name | (E)-3-[[4-(aminomethyl)-1-[(4-hydroxyphenyl)methyl]piperidin-4-yl]amino]-2-[N'-(2-fluoro-4-pyridinyl)carbamimidoyl]prop-2-enamide |
|---|---|
| PubChem CID | 137307713 |
| Molecular Formula | C22H28FN7O2 |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | (E)-3-[[4-(aminomethyl)-1-[(4-hydroxyphenyl)methyl]piperidin-4-yl]amino]-2-[N'-(2-fluoro-4-pyridinyl)carbamimidoyl]prop-2-enamide |
| SMILES | NCC1(N/C=C(C(N)=O)\C(N)=N\c2ccnc(F)c2)CCN(Cc2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C22H28FN7O2/c23-19-11-16(5-8-27-19)29-20(25)18(21(26)32)12-28-22(14-24)6-9-30(10-7-22)13-15-1-3-17(31)4-2-15/h1-5,8,11-12,28,31H,6-7,9-10,13-14,24H2,(H2,26,32)(H2,25,27,29)/b18-12+ |
| InChIKey | IETKRRGAYDNSFP-LDADJPATSA-N |
| XLogP | 0.87 |
| TPSA | 155.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|