C21H24F2N6O — CID 137208704
(E)-2-[N'-(4-fluorophenyl)carbamimidoyl]-3-[[1-[(2-fluoro-3-pyridinyl)methyl]piperidin-4-yl]amino]prop-2-enamide (PubChem CID 137208704) has the molecular formula C21H24F2N6O and a molecular weight of 414.46 g/mol. Its IUPAC name is (E)-2-[N'-(4-fluorophenyl)carbamimidoyl]-3-[[1-[(2-fluoro-3-pyridinyl)methyl]piperidin-4-yl]amino]prop-2-enamide.
| Compound Name | (E)-2-[N'-(4-fluorophenyl)carbamimidoyl]-3-[[1-[(2-fluoro-3-pyridinyl)methyl]piperidin-4-yl]amino]prop-2-enamide |
|---|---|
| PubChem CID | 137208704 |
| Molecular Formula | C21H24F2N6O |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | (E)-2-[N'-(4-fluorophenyl)carbamimidoyl]-3-[[1-[(2-fluoro-3-pyridinyl)methyl]piperidin-4-yl]amino]prop-2-enamide |
| SMILES | NC(=O)C(=C/NC1CCN(Cc2cccnc2F)CC1)/C(N)=N/c1ccc(F)cc1 |
| InChI | InChI=1S/C21H24F2N6O/c22-15-3-5-17(6-4-15)28-20(24)18(21(25)30)12-27-16-7-10-29(11-8-16)13-14-2-1-9-26-19(14)23/h1-6,9,12,16,27H,7-8,10-11,13H2,(H2,24,28)(H2,25,30)/b18-12+ |
| InChIKey | YRYJLRRLNODJFS-LDADJPATSA-N |
| XLogP | 1.97 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|