C22H29FN6O2 — CID 137208736
(E)-3-[[(4R)-4-cyano-1-[(3-methoxycyclobutyl)methyl]piperidin-3-yl]amino]-2-[N'-(4-fluorophenyl)carbamimidoyl]prop-2-enamide (PubChem CID 137208736) has the molecular formula C22H29FN6O2 and a molecular weight of 428.51 g/mol. Its IUPAC name is (E)-3-[[(4R)-4-cyano-1-[(3-methoxycyclobutyl)methyl]piperidin-3-yl]amino]-2-[N'-(4-fluorophenyl)carbamimidoyl]prop-2-enamide.
| Compound Name | (E)-3-[[(4R)-4-cyano-1-[(3-methoxycyclobutyl)methyl]piperidin-3-yl]amino]-2-[N'-(4-fluorophenyl)carbamimidoyl]prop-2-enamide |
|---|---|
| PubChem CID | 137208736 |
| Molecular Formula | C22H29FN6O2 |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | (E)-3-[[(4R)-4-cyano-1-[(3-methoxycyclobutyl)methyl]piperidin-3-yl]amino]-2-[N'-(4-fluorophenyl)carbamimidoyl]prop-2-enamide |
| SMILES | COC1CC(CN2CC[C@@H](C#N)C(N/C=C(C(N)=O)\C(N)=N\c3ccc(F)cc3)C2)C1 |
| InChI | InChI=1S/C22H29FN6O2/c1-31-18-8-14(9-18)12-29-7-6-15(10-24)20(13-29)27-11-19(22(26)30)21(25)28-17-4-2-16(23)3-5-17/h2-5,11,14-15,18,20,27H,6-9,12-13H2,1H3,(H2,25,28)(H2,26,30)/b19-11+/t14?,15-,18?,20?/m0/s1 |
| InChIKey | YVKFGAKRFDLPTB-PHQOUZTESA-N |
| XLogP | 1.41 |
| TPSA | 129.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|