C22H29FN6O — CID 137307688
(E)-3-[[1-(cyanomethyl)-4-(cyclopropylmethylamino)cyclohexyl]amino]-2-[N'-(4-fluorophenyl)carbamimidoyl]prop-2-enamide (PubChem CID 137307688) has the molecular formula C22H29FN6O and a molecular weight of 412.51 g/mol. Its IUPAC name is (E)-3-[[1-(cyanomethyl)-4-(cyclopropylmethylamino)cyclohexyl]amino]-2-[N'-(4-fluorophenyl)carbamimidoyl]prop-2-enamide.
| Compound Name | (E)-3-[[1-(cyanomethyl)-4-(cyclopropylmethylamino)cyclohexyl]amino]-2-[N'-(4-fluorophenyl)carbamimidoyl]prop-2-enamide |
|---|---|
| PubChem CID | 137307688 |
| Molecular Formula | C22H29FN6O |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | (E)-3-[[1-(cyanomethyl)-4-(cyclopropylmethylamino)cyclohexyl]amino]-2-[N'-(4-fluorophenyl)carbamimidoyl]prop-2-enamide |
| SMILES | N#CCC1(N/C=C(C(N)=O)\C(N)=N\c2ccc(F)cc2)CCC(NCC2CC2)CC1 |
| InChI | InChI=1S/C22H29FN6O/c23-16-3-5-18(6-4-16)29-20(25)19(21(26)30)14-28-22(11-12-24)9-7-17(8-10-22)27-13-15-1-2-15/h3-6,14-15,17,27-28H,1-2,7-11,13H2,(H2,25,29)(H2,26,30)/b19-14+ |
| InChIKey | JPGFMAREHWEIFK-XMHGGMMESA-N |
| XLogP | 2.37 |
| TPSA | 129.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|