C26H29ClN6O2S — CID 145394477
N-[(E)-1-amino-2-carbamoyl-3-[[1-[[4-(5-chlorothiophen-2-yl)phenyl]methyl]-4-(cyanomethyl)piperidin-4-yl]amino]prop-2-enylidene]cyclopropanecarboxamide (PubChem CID 145394477) has the molecular formula C26H29ClN6O2S and a molecular weight of 525.08 g/mol. Its IUPAC name is N-[(E)-1-amino-2-carbamoyl-3-[[1-[[4-(5-chlorothiophen-2-yl)phenyl]methyl]-4-(cyanomethyl)piperidin-4-yl]amino]prop-2-enylidene]cyclopropanecarboxamide.
| Compound Name | N-[(E)-1-amino-2-carbamoyl-3-[[1-[[4-(5-chlorothiophen-2-yl)phenyl]methyl]-4-(cyanomethyl)piperidin-4-yl]amino]prop-2-enylidene]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 145394477 |
| Molecular Formula | C26H29ClN6O2S |
| Molecular Weight | 525.08 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | N-[(E)-1-amino-2-carbamoyl-3-[[1-[[4-(5-chlorothiophen-2-yl)phenyl]methyl]-4-(cyanomethyl)piperidin-4-yl]amino]prop-2-enylidene]cyclopropanecarboxamide |
| SMILES | N#CCC1(N/C=C(C(N)=O)\C(N)=N\C(=O)C2CC2)CCN(Cc2ccc(-c3ccc(Cl)s3)cc2)CC1 |
| InChI | InChI=1S/C26H29ClN6O2S/c27-22-8-7-21(36-22)18-3-1-17(2-4-18)16-33-13-10-26(9-12-28,11-14-33)31-15-20(24(30)34)23(29)32-25(35)19-5-6-19/h1-4,7-8,15,19,31H,5-6,9-11,13-14,16H2,(H2,30,34)(H2,29,32,35)/b20-15+ |
| InChIKey | BHRKPPWWTZCGHP-HMMYKYKNSA-N |
| XLogP | 3.57 |
| TPSA | 137.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.08 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|