C19H24ClN5O — CID 144556315
acetylene;(E)-2-[N'-(4-chlorophenyl)carbamimidoyl]-3-(cyclohexylamino)prop-2-enamide;formonitrile (PubChem CID 144556315) has the molecular formula C19H24ClN5O and a molecular weight of 373.89 g/mol. Its IUPAC name is acetylene;(E)-2-[N'-(4-chlorophenyl)carbamimidoyl]-3-(cyclohexylamino)prop-2-enamide;formonitrile.
| Compound Name | acetylene;(E)-2-[N'-(4-chlorophenyl)carbamimidoyl]-3-(cyclohexylamino)prop-2-enamide;formonitrile |
|---|---|
| PubChem CID | 144556315 |
| Molecular Formula | C19H24ClN5O |
| Molecular Weight | 373.89 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | acetylene;(E)-2-[N'-(4-chlorophenyl)carbamimidoyl]-3-(cyclohexylamino)prop-2-enamide;formonitrile |
| SMILES | C#C.C#N.NC(=O)C(=C/NC1CCCCC1)/C(N)=N/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H21ClN4O.C2H2.CHN/c17-11-6-8-13(9-7-11)21-15(18)14(16(19)22)10-20-12-4-2-1-3-5-12;2*1-2/h6-10,12,20H,1-5H2,(H2,18,21)(H2,19,22);1-2H;1H/b14-10+;; |
| InChIKey | JAFVJQDZUDOQFM-YZEJZXAXSA-N |
| XLogP | 3.01 |
| TPSA | 117.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.89 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|