C22H27ClFN7O — CID 137307712
(E)-3-[[1-(aminomethyl)-4-(3-chloroanilino)cyclohexyl]amino]-2-[N'-(2-fluoro-4-pyridinyl)carbamimidoyl]prop-2-enamide (PubChem CID 137307712) has the molecular formula C22H27ClFN7O and a molecular weight of 459.96 g/mol. Its IUPAC name is (E)-3-[[1-(aminomethyl)-4-(3-chloroanilino)cyclohexyl]amino]-2-[N'-(2-fluoro-4-pyridinyl)carbamimidoyl]prop-2-enamide.
| Compound Name | (E)-3-[[1-(aminomethyl)-4-(3-chloroanilino)cyclohexyl]amino]-2-[N'-(2-fluoro-4-pyridinyl)carbamimidoyl]prop-2-enamide |
|---|---|
| PubChem CID | 137307712 |
| Molecular Formula | C22H27ClFN7O |
| Molecular Weight | 459.96 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | (E)-3-[[1-(aminomethyl)-4-(3-chloroanilino)cyclohexyl]amino]-2-[N'-(2-fluoro-4-pyridinyl)carbamimidoyl]prop-2-enamide |
| SMILES | NCC1(N/C=C(C(N)=O)\C(N)=N\c2ccnc(F)c2)CCC(Nc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C22H27ClFN7O/c23-14-2-1-3-16(10-14)30-15-4-7-22(13-25,8-5-15)29-12-18(21(27)32)20(26)31-17-6-9-28-19(24)11-17/h1-3,6,9-12,15,29-30H,4-5,7-8,13,25H2,(H2,27,32)(H2,26,28,31)/b18-12+ |
| InChIKey | ZGOXOHAIXVNAKH-LDADJPATSA-N |
| XLogP | 2.57 |
| TPSA | 144.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.96 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|