C24H33F3N6O3S — CID 144556160
(E)-3-[[(1S,2S,4R)-4-(1-cyclopropylethylamino)-2-(methyliminomethyl)cyclohexyl]amino]-2-[N'-[4-(trifluoromethylsulfonyl)phenyl]carbamimidoyl]prop-2-enamide (PubChem CID 144556160) has the molecular formula C24H33F3N6O3S and a molecular weight of 542.63 g/mol. Its IUPAC name is (E)-3-[[(1S,2S,4R)-4-(1-cyclopropylethylamino)-2-(methyliminomethyl)cyclohexyl]amino]-2-[N'-[4-(trifluoromethylsulfonyl)phenyl]carbamimidoyl]prop-2-enamide.
| Compound Name | (E)-3-[[(1S,2S,4R)-4-(1-cyclopropylethylamino)-2-(methyliminomethyl)cyclohexyl]amino]-2-[N'-[4-(trifluoromethylsulfonyl)phenyl]carbamimidoyl]prop-2-enamide |
|---|---|
| PubChem CID | 144556160 |
| Molecular Formula | C24H33F3N6O3S |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | (E)-3-[[(1S,2S,4R)-4-(1-cyclopropylethylamino)-2-(methyliminomethyl)cyclohexyl]amino]-2-[N'-[4-(trifluoromethylsulfonyl)phenyl]carbamimidoyl]prop-2-enamide |
| SMILES | C/N=C/[C@H]1C[C@H](NC(C)C2CC2)CC[C@@H]1N/C=C(C(N)=O)\C(N)=N\c1ccc(S(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H33F3N6O3S/c1-14(15-3-4-15)32-18-7-10-21(16(11-18)12-30-2)31-13-20(23(29)34)22(28)33-17-5-8-19(9-6-17)37(35,36)24(25,26)27/h5-6,8-9,12-16,18,21,31-32H,3-4,7,10-11H2,1-2H3,(H2,28,33)(H2,29,34)/b20-13+,30-12+/t14?,16-,18-,21+/m1/s1 |
| InChIKey | YQRYUJFVTTXMFT-HCDILJGOSA-N |
| XLogP | 2.55 |
| TPSA | 152.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|