C23H31F3N6O3S — CID 137176662
(E)-3-[[(1S,2S,4R)-4-(1-cyclopropylethylamino)-2-methanimidoylcyclohexyl]amino]-2-[N'-[4-(trifluoromethylsulfonyl)phenyl]carbamimidoyl]prop-2-enamide (PubChem CID 137176662) has the molecular formula C23H31F3N6O3S and a molecular weight of 528.60 g/mol. Its IUPAC name is (E)-3-[[(1S,2S,4R)-4-(1-cyclopropylethylamino)-2-methanimidoylcyclohexyl]amino]-2-[N'-[4-(trifluoromethylsulfonyl)phenyl]carbamimidoyl]prop-2-enamide.
| Compound Name | (E)-3-[[(1S,2S,4R)-4-(1-cyclopropylethylamino)-2-methanimidoylcyclohexyl]amino]-2-[N'-[4-(trifluoromethylsulfonyl)phenyl]carbamimidoyl]prop-2-enamide |
|---|---|
| PubChem CID | 137176662 |
| Molecular Formula | C23H31F3N6O3S |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | (E)-3-[[(1S,2S,4R)-4-(1-cyclopropylethylamino)-2-methanimidoylcyclohexyl]amino]-2-[N'-[4-(trifluoromethylsulfonyl)phenyl]carbamimidoyl]prop-2-enamide |
| SMILES | [H]/N=C/[C@H]1C[C@H](NC(C)C2CC2)CC[C@@H]1N/C=C(C(N)=O)\C(N)=N\c1ccc(S(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H31F3N6O3S/c1-13(14-2-3-14)31-17-6-9-20(15(10-17)11-27)30-12-19(22(29)33)21(28)32-16-4-7-18(8-5-16)36(34,35)23(24,25)26/h4-5,7-8,11-15,17,20,27,30-31H,2-3,6,9-10H2,1H3,(H2,28,32)(H2,29,33)/b19-12+,27-11+/t13?,15-,17-,20+/m1/s1 |
| InChIKey | FRGJPRZZBOWZRZ-QPICOIFXSA-N |
| XLogP | 2.50 |
| TPSA | 163.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|