C26H33F3N6O3S — CID 144556333
(E)-3-[[(1S,2S,4S)-2-cyano-4-[dicyclopropylmethyl(methyl)amino]cyclohexyl]amino]-2-[N'-[4-(trifluoromethylsulfonyl)phenyl]carbamimidoyl]prop-2-enamide (PubChem CID 144556333) has the molecular formula C26H33F3N6O3S and a molecular weight of 566.65 g/mol. Its IUPAC name is (E)-3-[[(1S,2S,4S)-2-cyano-4-[dicyclopropylmethyl(methyl)amino]cyclohexyl]amino]-2-[N'-[4-(trifluoromethylsulfonyl)phenyl]carbamimidoyl]prop-2-enamide.
| Compound Name | (E)-3-[[(1S,2S,4S)-2-cyano-4-[dicyclopropylmethyl(methyl)amino]cyclohexyl]amino]-2-[N'-[4-(trifluoromethylsulfonyl)phenyl]carbamimidoyl]prop-2-enamide |
|---|---|
| PubChem CID | 144556333 |
| Molecular Formula | C26H33F3N6O3S |
| Molecular Weight | 566.65 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | (E)-3-[[(1S,2S,4S)-2-cyano-4-[dicyclopropylmethyl(methyl)amino]cyclohexyl]amino]-2-[N'-[4-(trifluoromethylsulfonyl)phenyl]carbamimidoyl]prop-2-enamide |
| SMILES | CN(C(C1CC1)C1CC1)[C@H]1CC[C@H](N/C=C(C(N)=O)\C(N)=N\c2ccc(S(=O)(=O)C(F)(F)F)cc2)[C@@H](C#N)C1 |
| InChI | InChI=1S/C26H33F3N6O3S/c1-35(23(15-2-3-15)16-4-5-16)19-8-11-22(17(12-19)13-30)33-14-21(25(32)36)24(31)34-18-6-9-20(10-7-18)39(37,38)26(27,28)29/h6-7,9-10,14-17,19,22-23,33H,2-5,8,11-12H2,1H3,(H2,31,34)(H2,32,36)/b21-14+/t17-,19+,22+/m1/s1 |
| InChIKey | YOIYBMKLTCDVRJ-LEGOWFDESA-N |
| XLogP | 3.11 |
| TPSA | 154.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.65 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|