C17H20F3N5O3 — CID 144556605
formonitrile;(E)-3-(oxan-3-ylamino)-2-[N'-[4-(trifluoromethoxy)phenyl]carbamimidoyl]prop-2-enamide (PubChem CID 144556605) has the molecular formula C17H20F3N5O3 and a molecular weight of 399.37 g/mol. Its IUPAC name is formonitrile;(E)-3-(oxan-3-ylamino)-2-[N'-[4-(trifluoromethoxy)phenyl]carbamimidoyl]prop-2-enamide.
| Compound Name | formonitrile;(E)-3-(oxan-3-ylamino)-2-[N'-[4-(trifluoromethoxy)phenyl]carbamimidoyl]prop-2-enamide |
|---|---|
| PubChem CID | 144556605 |
| Molecular Formula | C17H20F3N5O3 |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | formonitrile;(E)-3-(oxan-3-ylamino)-2-[N'-[4-(trifluoromethoxy)phenyl]carbamimidoyl]prop-2-enamide |
| SMILES | C#N.NC(=O)C(=C/NC1CCCOC1)/C(N)=N/c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H19F3N4O3.CHN/c17-16(18,19)26-12-5-3-10(4-6-12)23-14(20)13(15(21)24)8-22-11-2-1-7-25-9-11;1-2/h3-6,8,11,22H,1-2,7,9H2,(H2,20,23)(H2,21,24);1H/b13-8+; |
| InChIKey | PZJHLCCALJGFEC-FNXZNAJJSA-N |
| XLogP | 1.85 |
| TPSA | 135.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|