C27H27N3O4 — CID 164543941
1-N'-[4-(hydroxycarbamoyl)-3-phenylphenyl]-1-N-phenylcyclohexane-1,1-dicarboxamide (PubChem CID 164543941) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is 1-N'-[4-(hydroxycarbamoyl)-3-phenylphenyl]-1-N-phenylcyclohexane-1,1-dicarboxamide.
| Compound Name | 1-N'-[4-(hydroxycarbamoyl)-3-phenylphenyl]-1-N-phenylcyclohexane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 164543941 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 1-N'-[4-(hydroxycarbamoyl)-3-phenylphenyl]-1-N-phenylcyclohexane-1,1-dicarboxamide |
| SMILES | O=C(NO)c1ccc(NC(=O)C2(C(=O)Nc3ccccc3)CCCCC2)cc1-c1ccccc1 |
| InChI | InChI=1S/C27H27N3O4/c31-24(30-34)22-15-14-21(18-23(22)19-10-4-1-5-11-19)29-26(33)27(16-8-3-9-17-27)25(32)28-20-12-6-2-7-13-20/h1-2,4-7,10-15,18,34H,3,8-9,16-17H2,(H,28,32)(H,29,33)(H,30,31) |
| InChIKey | QQUXBFZJRZUEBK-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|